C23H21N5O — CID 1082591
2-amino-4,6-dimethyl-5-[(4-morpholin-4-ylphenyl)methylidene]cyclopenta[b]pyridine-3,7-dicarbonitrile (PubChem CID 1082591) has the molecular formula C23H21N5O and a molecular weight of 383.46 g/mol. Its IUPAC name is 2-amino-4,6-dimethyl-5-[(4-morpholin-4-ylphenyl)methylidene]cyclopenta[b]pyridine-3,7-dicarbonitrile.
| Compound Name | 2-amino-4,6-dimethyl-5-[(4-morpholin-4-ylphenyl)methylidene]cyclopenta[b]pyridine-3,7-dicarbonitrile |
|---|---|
| PubChem CID | 1082591 |
| Molecular Formula | C23H21N5O |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-amino-4,6-dimethyl-5-[(4-morpholin-4-ylphenyl)methylidene]cyclopenta[b]pyridine-3,7-dicarbonitrile |
| SMILES | CC1=C(C#N)c2nc(N)c(C#N)c(C)c2C1=Cc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H21N5O/c1-14-18(11-16-3-5-17(6-4-16)28-7-9-29-10-8-28)21-15(2)20(13-25)23(26)27-22(21)19(14)12-24/h3-6,11H,7-10H2,1-2H3,(H2,26,27) |
| InChIKey | CCWMSGVIDBPNNF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_B(7)', 'substructure': 'N/A'} |
|---|