C27H29N5 — CID 124649020
(5Z)-2-amino-5-[[(4R)-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl]methylidene]-4,6-dimethylcyclopenta[b]pyridine-3,7-dicarbonitrile (PubChem CID 124649020) has the molecular formula C27H29N5 and a molecular weight of 423.56 g/mol. Its IUPAC name is (5Z)-2-amino-5-[[(4R)-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl]methylidene]-4,6-dimethylcyclopenta[b]pyridine-3,7-dicarbonitrile.
| Compound Name | (5Z)-2-amino-5-[[(4R)-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl]methylidene]-4,6-dimethylcyclopenta[b]pyridine-3,7-dicarbonitrile |
|---|---|
| PubChem CID | 124649020 |
| Molecular Formula | C27H29N5 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | (5Z)-2-amino-5-[[(4R)-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl]methylidene]-4,6-dimethylcyclopenta[b]pyridine-3,7-dicarbonitrile |
| SMILES | CCN1c2ccc(/C=C3/C(C)=C(C#N)c4nc(N)c(C#N)c(C)c43)cc2[C@H](C)CC1(C)C |
| InChI | InChI=1S/C27H29N5/c1-7-32-23-9-8-18(10-19(23)15(2)12-27(32,5)6)11-20-16(3)21(13-28)25-24(20)17(4)22(14-29)26(30)31-25/h8-11,15H,7,12H2,1-6H3,(H2,30,31)/b20-11-/t15-/m1/s1 |
| InChIKey | PCYPFMKGUZCQQU-UWOKGBPVSA-N |
| XLogP | 5.81 |
| TPSA | 89.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_B(7)', 'substructure': 'N/A'} |
|---|