C23H26N2 — CID 50860330
(E)-3-(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-2-phenylprop-2-enenitrile (PubChem CID 50860330) has the molecular formula C23H26N2 and a molecular weight of 330.48 g/mol. Its IUPAC name is (E)-3-(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-2-phenylprop-2-enenitrile.
| Compound Name | (E)-3-(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-2-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 50860330 |
| Molecular Formula | C23H26N2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (E)-3-(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-2-phenylprop-2-enenitrile |
| SMILES | CCN1c2ccc(/C=C(/C#N)c3ccccc3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C23H26N2/c1-5-25-22-12-11-18(14-21(22)17(2)15-23(25,3)4)13-20(16-24)19-9-7-6-8-10-19/h6-14,17H,5,15H2,1-4H3/b20-13- |
| InChIKey | MWRUNEZDKBDNQB-MOSHPQCFSA-N |
| XLogP | 5.86 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|