C23H26N2 — CID 99886091
(Z)-3-[(4R)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]-2-phenylprop-2-enenitrile (PubChem CID 99886091) has the molecular formula C23H26N2 and a molecular weight of 330.48 g/mol. Its IUPAC name is (Z)-3-[(4R)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]-2-phenylprop-2-enenitrile.
| Compound Name | (Z)-3-[(4R)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]-2-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 99886091 |
| Molecular Formula | C23H26N2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (Z)-3-[(4R)-1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl]-2-phenylprop-2-enenitrile |
| SMILES | Cc1cc2c(cc1/C=C(\C#N)c1ccccc1)[C@H](C)CC(C)(C)N2C |
| InChI | InChI=1S/C23H26N2/c1-16-11-22-21(17(2)14-23(3,4)25(22)5)13-19(16)12-20(15-24)18-9-7-6-8-10-18/h6-13,17H,14H2,1-5H3/b20-12+/t17-/m1/s1 |
| InChIKey | LHYVVRMOQURJES-XNHPLOEXSA-N |
| XLogP | 5.78 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|