C18H21ClN3+ — CID 7324662
2-amino-4-(2-chlorophenyl)-5-methyl-6-[(2R)-2-methylbutyl]pyridin-1-ium-3-carbonitrile (PubChem CID 7324662) has the molecular formula C18H21ClN3+ and a molecular weight of 314.84 g/mol. Its IUPAC name is 2-amino-4-(2-chlorophenyl)-5-methyl-6-[(2R)-2-methylbutyl]pyridin-1-ium-3-carbonitrile.
| Compound Name | 2-amino-4-(2-chlorophenyl)-5-methyl-6-[(2R)-2-methylbutyl]pyridin-1-ium-3-carbonitrile |
|---|---|
| PubChem CID | 7324662 |
| Molecular Formula | C18H21ClN3+ |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-amino-4-(2-chlorophenyl)-5-methyl-6-[(2R)-2-methylbutyl]pyridin-1-ium-3-carbonitrile |
| SMILES | CC[C@@H](C)Cc1[nH+]c(N)c(C#N)c(-c2ccccc2Cl)c1C |
| InChI | InChI=1S/C18H20ClN3/c1-4-11(2)9-16-12(3)17(14(10-20)18(21)22-16)13-7-5-6-8-15(13)19/h5-8,11H,4,9H2,1-3H3,(H2,21,22)/p+1/t11-/m1/s1 |
| InChIKey | VOGHVICLQXVGEL-LLVKDONJSA-O |
| XLogP | 4.17 |
| TPSA | 63.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |