C19H18N3+ — CID 6952838
2-amino-6-ethyl-5-methyl-4-naphthalen-1-ylpyridin-1-ium-3-carbonitrile (PubChem CID 6952838) has the molecular formula C19H18N3+ and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-amino-6-ethyl-5-methyl-4-naphthalen-1-ylpyridin-1-ium-3-carbonitrile.
| Compound Name | 2-amino-6-ethyl-5-methyl-4-naphthalen-1-ylpyridin-1-ium-3-carbonitrile |
|---|---|
| PubChem CID | 6952838 |
| Molecular Formula | C19H18N3+ |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-amino-6-ethyl-5-methyl-4-naphthalen-1-ylpyridin-1-ium-3-carbonitrile |
| SMILES | CCc1[nH+]c(N)c(C#N)c(-c2cccc3ccccc23)c1C |
| InChI | InChI=1S/C19H17N3/c1-3-17-12(2)18(16(11-20)19(21)22-17)15-10-6-8-13-7-4-5-9-14(13)15/h4-10H,3H2,1-2H3,(H2,21,22)/p+1 |
| InChIKey | PBJCBXJZXYSMTO-UHFFFAOYSA-O |
| XLogP | 3.65 |
| TPSA | 63.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |