C17H20N3O2+ — CID 6951887
2-amino-4-(3-ethoxy-4-hydroxyphenyl)-6-ethyl-5-methylpyridin-1-ium-3-carbonitrile (PubChem CID 6951887) has the molecular formula C17H20N3O2+ and a molecular weight of 298.37 g/mol. Its IUPAC name is 2-amino-4-(3-ethoxy-4-hydroxyphenyl)-6-ethyl-5-methylpyridin-1-ium-3-carbonitrile.
| Compound Name | 2-amino-4-(3-ethoxy-4-hydroxyphenyl)-6-ethyl-5-methylpyridin-1-ium-3-carbonitrile |
|---|---|
| PubChem CID | 6951887 |
| Molecular Formula | C17H20N3O2+ |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2-amino-4-(3-ethoxy-4-hydroxyphenyl)-6-ethyl-5-methylpyridin-1-ium-3-carbonitrile |
| SMILES | CCOc1cc(-c2c(C)c(CC)[nH+]c(N)c2C#N)ccc1O |
| InChI | InChI=1S/C17H19N3O2/c1-4-13-10(3)16(12(9-18)17(19)20-13)11-6-7-14(21)15(8-11)22-5-2/h6-8,21H,4-5H2,1-3H3,(H2,19,20)/p+1 |
| InChIKey | YNDFBHOSDMSBSV-UHFFFAOYSA-O |
| XLogP | 2.60 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |