C24H26N3O2+ — CID 7378052
2-amino-5-butyl-4-(3,4-dimethoxyphenyl)-6-phenylpyridin-1-ium-3-carbonitrile (PubChem CID 7378052) has the molecular formula C24H26N3O2+ and a molecular weight of 388.49 g/mol. Its IUPAC name is 2-amino-5-butyl-4-(3,4-dimethoxyphenyl)-6-phenylpyridin-1-ium-3-carbonitrile.
| Compound Name | 2-amino-5-butyl-4-(3,4-dimethoxyphenyl)-6-phenylpyridin-1-ium-3-carbonitrile |
|---|---|
| PubChem CID | 7378052 |
| Molecular Formula | C24H26N3O2+ |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 2-amino-5-butyl-4-(3,4-dimethoxyphenyl)-6-phenylpyridin-1-ium-3-carbonitrile |
| SMILES | CCCCc1c(-c2ccccc2)[nH+]c(N)c(C#N)c1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C24H25N3O2/c1-4-5-11-18-22(17-12-13-20(28-2)21(14-17)29-3)19(15-25)24(26)27-23(18)16-9-7-6-8-10-16/h6-10,12-14H,4-5,11H2,1-3H3,(H2,26,27)/p+1 |
| InChIKey | GMNVFISXNQRCNA-UHFFFAOYSA-O |
| XLogP | 4.65 |
| TPSA | 82.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |