C21H27BrN3+ — CID 2191621
2-amino-3-(3-bromophenyl)-5-butyl-6-pentylpyridin-1-ium-4-carbonitrile (PubChem CID 2191621) has the molecular formula C21H27BrN3+ and a molecular weight of 401.37 g/mol. Its IUPAC name is 2-amino-3-(3-bromophenyl)-5-butyl-6-pentylpyridin-1-ium-4-carbonitrile.
| Compound Name | 2-amino-3-(3-bromophenyl)-5-butyl-6-pentylpyridin-1-ium-4-carbonitrile |
|---|---|
| PubChem CID | 2191621 |
| Molecular Formula | C21H27BrN3+ |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-amino-3-(3-bromophenyl)-5-butyl-6-pentylpyridin-1-ium-4-carbonitrile |
| SMILES | CCCCCc1[nH+]c(N)c(-c2cccc(Br)c2)c(C#N)c1CCCC |
| InChI | InChI=1S/C21H26BrN3/c1-3-5-7-12-19-17(11-6-4-2)18(14-23)20(21(24)25-19)15-9-8-10-16(22)13-15/h8-10,13H,3-7,11-12H2,1-2H3,(H2,24,25)/p+1 |
| InChIKey | VJBBLKOYTCCSKE-UHFFFAOYSA-O |
| XLogP | 5.46 |
| TPSA | 63.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|