C17H23BrN2O — CID 66199444
4-(3-bromophenyl)-5-octyl-1,2-oxazol-3-amine (PubChem CID 66199444) has the molecular formula C17H23BrN2O and a molecular weight of 351.29 g/mol. Its IUPAC name is 4-(3-bromophenyl)-5-octyl-1,2-oxazol-3-amine.
| Compound Name | 4-(3-bromophenyl)-5-octyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66199444 |
| Molecular Formula | C17H23BrN2O |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 4-(3-bromophenyl)-5-octyl-1,2-oxazol-3-amine |
| SMILES | CCCCCCCCc1onc(N)c1-c1cccc(Br)c1 |
| InChI | InChI=1S/C17H23BrN2O/c1-2-3-4-5-6-7-11-15-16(17(19)20-21-15)13-9-8-10-14(18)12-13/h8-10,12H,2-7,11H2,1H3,(H2,19,20) |
| InChIKey | PBHGHHYLPWLWHI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|