C16H20Cl2N2O — CID 66206625
4-(2,6-dichlorophenyl)-5-heptyl-1,2-oxazol-3-amine (PubChem CID 66206625) has the molecular formula C16H20Cl2N2O and a molecular weight of 327.25 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-5-heptyl-1,2-oxazol-3-amine.
| Compound Name | 4-(2,6-dichlorophenyl)-5-heptyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66206625 |
| Molecular Formula | C16H20Cl2N2O |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 4-(2,6-dichlorophenyl)-5-heptyl-1,2-oxazol-3-amine |
| SMILES | CCCCCCCc1onc(N)c1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H20Cl2N2O/c1-2-3-4-5-6-10-13-15(16(19)20-21-13)14-11(17)8-7-9-12(14)18/h7-9H,2-6,10H2,1H3,(H2,19,20) |
| InChIKey | FLYUOVQVHWPUDF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|