C13H14Cl2N2O — CID 66206819
4-(2,6-dichlorophenyl)-5-(2-methylpropyl)-1,2-oxazol-3-amine (PubChem CID 66206819) has the molecular formula C13H14Cl2N2O and a molecular weight of 285.17 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-5-(2-methylpropyl)-1,2-oxazol-3-amine.
| Compound Name | 4-(2,6-dichlorophenyl)-5-(2-methylpropyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66206819 |
| Molecular Formula | C13H14Cl2N2O |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 4-(2,6-dichlorophenyl)-5-(2-methylpropyl)-1,2-oxazol-3-amine |
| SMILES | CC(C)Cc1onc(N)c1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H14Cl2N2O/c1-7(2)6-10-12(13(16)17-18-10)11-8(14)4-3-5-9(11)15/h3-5,7H,6H2,1-2H3,(H2,16,17) |
| InChIKey | NIEASUHJPVMBEV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |