C17H24N2O — CID 66203226
5-pentyl-4-(4-propan-2-ylphenyl)-1,2-oxazol-3-amine (PubChem CID 66203226) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 5-pentyl-4-(4-propan-2-ylphenyl)-1,2-oxazol-3-amine.
| Compound Name | 5-pentyl-4-(4-propan-2-ylphenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66203226 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 5-pentyl-4-(4-propan-2-ylphenyl)-1,2-oxazol-3-amine |
| SMILES | CCCCCc1onc(N)c1-c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C17H24N2O/c1-4-5-6-7-15-16(17(18)19-20-15)14-10-8-13(9-11-14)12(2)3/h8-12H,4-7H2,1-3H3,(H2,18,19) |
| InChIKey | IJOZVCMLHJCWDW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|