C16H20ClFN2O — CID 82792888
4-(3-chloro-2-fluorophenyl)-5-heptyl-1,2-oxazol-3-amine (PubChem CID 82792888) has the molecular formula C16H20ClFN2O and a molecular weight of 310.80 g/mol. Its IUPAC name is 4-(3-chloro-2-fluorophenyl)-5-heptyl-1,2-oxazol-3-amine.
| Compound Name | 4-(3-chloro-2-fluorophenyl)-5-heptyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 82792888 |
| Molecular Formula | C16H20ClFN2O |
| Molecular Weight | 310.80 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 4-(3-chloro-2-fluorophenyl)-5-heptyl-1,2-oxazol-3-amine |
| SMILES | CCCCCCCc1onc(N)c1-c1cccc(Cl)c1F |
| InChI | InChI=1S/C16H20ClFN2O/c1-2-3-4-5-6-10-13-14(16(19)20-21-13)11-8-7-9-12(17)15(11)18/h7-9H,2-6,10H2,1H3,(H2,19,20) |
| InChIKey | XGLYOKFMTNVBKT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.80 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|