C12H12ClFN2O — CID 82808316
4-(3-chloro-2-fluorophenyl)-5-propan-2-yl-1,2-oxazol-3-amine (PubChem CID 82808316) has the molecular formula C12H12ClFN2O and a molecular weight of 254.69 g/mol. Its IUPAC name is 4-(3-chloro-2-fluorophenyl)-5-propan-2-yl-1,2-oxazol-3-amine.
| Compound Name | 4-(3-chloro-2-fluorophenyl)-5-propan-2-yl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 82808316 |
| Molecular Formula | C12H12ClFN2O |
| Molecular Weight | 254.69 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 4-(3-chloro-2-fluorophenyl)-5-propan-2-yl-1,2-oxazol-3-amine |
| SMILES | CC(C)c1onc(N)c1-c1cccc(Cl)c1F |
| InChI | InChI=1S/C12H12ClFN2O/c1-6(2)11-9(12(15)16-17-11)7-4-3-5-8(13)10(7)14/h3-6H,1-2H3,(H2,15,16) |
| InChIKey | KEZLWOIQEBEHSK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.69 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |