C14H17ClFN3 — CID 114875056
4-(3-chloro-2-fluorophenyl)-5-(2-methylbutyl)-1H-pyrazol-3-amine (PubChem CID 114875056) has the molecular formula C14H17ClFN3 and a molecular weight of 281.76 g/mol. Its IUPAC name is 4-(3-chloro-2-fluorophenyl)-5-(2-methylbutyl)-1H-pyrazol-3-amine.
| Compound Name | 4-(3-chloro-2-fluorophenyl)-5-(2-methylbutyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 114875056 |
| Molecular Formula | C14H17ClFN3 |
| Molecular Weight | 281.76 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 4-(3-chloro-2-fluorophenyl)-5-(2-methylbutyl)-1H-pyrazol-3-amine |
| SMILES | CCC(C)Cc1[nH]nc(N)c1-c1cccc(Cl)c1F |
| InChI | InChI=1S/C14H17ClFN3/c1-3-8(2)7-11-12(14(17)19-18-11)9-5-4-6-10(15)13(9)16/h4-6,8H,3,7H2,1-2H3,(H3,17,18,19) |
| InChIKey | FWBJTASASDFTLL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.76 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |