C14H17ClN2O2 — CID 66198020
5-butyl-4-(5-chloro-2-methoxyphenyl)-1,2-oxazol-3-amine (PubChem CID 66198020) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. Its IUPAC name is 5-butyl-4-(5-chloro-2-methoxyphenyl)-1,2-oxazol-3-amine.
| Compound Name | 5-butyl-4-(5-chloro-2-methoxyphenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66198020 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 5-butyl-4-(5-chloro-2-methoxyphenyl)-1,2-oxazol-3-amine |
| SMILES | CCCCc1onc(N)c1-c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C14H17ClN2O2/c1-3-4-5-12-13(14(16)17-19-12)10-8-9(15)6-7-11(10)18-2/h6-8H,3-5H2,1-2H3,(H2,16,17) |
| InChIKey | KQQPEEXXFDSQRV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |