C20H18N3O+ — CID 7386481
2-amino-4-(2-methoxyphenyl)-6-(4-methylphenyl)pyridin-1-ium-3-carbonitrile (PubChem CID 7386481) has the molecular formula C20H18N3O+ and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-amino-4-(2-methoxyphenyl)-6-(4-methylphenyl)pyridin-1-ium-3-carbonitrile.
| Compound Name | 2-amino-4-(2-methoxyphenyl)-6-(4-methylphenyl)pyridin-1-ium-3-carbonitrile |
|---|---|
| PubChem CID | 7386481 |
| Molecular Formula | C20H18N3O+ |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-amino-4-(2-methoxyphenyl)-6-(4-methylphenyl)pyridin-1-ium-3-carbonitrile |
| SMILES | COc1ccccc1-c1cc(-c2ccc(C)cc2)[nH+]c(N)c1C#N |
| InChI | InChI=1S/C20H17N3O/c1-13-7-9-14(10-8-13)18-11-16(17(12-21)20(22)23-18)15-5-3-4-6-19(15)24-2/h3-11H,1-2H3,(H2,22,23)/p+1 |
| InChIKey | QBVZDPBZHNXMGY-UHFFFAOYSA-O |
| XLogP | 3.61 |
| TPSA | 73.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |