C19H16N3O2+ — CID 6951829
2-amino-6-(4-hydroxyphenyl)-4-(4-methoxyphenyl)pyridin-1-ium-3-carbonitrile (PubChem CID 6951829) has the molecular formula C19H16N3O2+ and a molecular weight of 318.36 g/mol. Its IUPAC name is 2-amino-6-(4-hydroxyphenyl)-4-(4-methoxyphenyl)pyridin-1-ium-3-carbonitrile.
| Compound Name | 2-amino-6-(4-hydroxyphenyl)-4-(4-methoxyphenyl)pyridin-1-ium-3-carbonitrile |
|---|---|
| PubChem CID | 6951829 |
| Molecular Formula | C19H16N3O2+ |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-amino-6-(4-hydroxyphenyl)-4-(4-methoxyphenyl)pyridin-1-ium-3-carbonitrile |
| SMILES | COc1ccc(-c2cc(-c3ccc(O)cc3)[nH+]c(N)c2C#N)cc1 |
| InChI | InChI=1S/C19H15N3O2/c1-24-15-8-4-12(5-9-15)16-10-18(22-19(21)17(16)11-20)13-2-6-14(23)7-3-13/h2-10,23H,1H3,(H2,21,22)/p+1 |
| InChIKey | MMTPAPVBJBBVEW-UHFFFAOYSA-O |
| XLogP | 3.00 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |