C7Cl3N3 — CID 15206362
2,4,6-trichloropyridine-3,5-dicarbonitrile (PubChem CID 15206362) has the molecular formula C7Cl3N3 and a molecular weight of 232.46 g/mol. Its IUPAC name is 2,4,6-trichloropyridine-3,5-dicarbonitrile.
| Compound Name | 2,4,6-trichloropyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 15206362 |
| Molecular Formula | C7Cl3N3 |
| Molecular Weight | 232.46 g/mol |
| Exact Mass | 230.92 |
| IUPAC Name | 2,4,6-trichloropyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(Cl)nc(Cl)c(C#N)c1Cl |
| InChI | InChI=1S/C7Cl3N3/c8-5-3(1-11)6(9)13-7(10)4(5)2-12 |
| InChIKey | JBTPSLFCXVZWLF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|