About 2,4,6-trichloropyridine-3,5-dicarbonitrile
2,4,6-trichloropyridine-3,5-dicarbonitrile (PubChem CID 15206362) has the molecular formula C7Cl3N3
and a molecular weight of 232.46 g/mol. Its IUPAC name is 2,4,6-trichloropyridine-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2,4,6-trichloropyridine-3,5-dicarbonitrile |
| PubChem CID | 15206362 |
| Molecular Formula | C7Cl3N3 |
| Molecular Weight | 232.46 g/mol |
| Exact Mass | 230.92 |
| IUPAC Name | 2,4,6-trichloropyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(Cl)nc(Cl)c(C#N)c1Cl |
| InChI | InChI=1S/C7Cl3N3/c8-5-3(1-11)6(9)13-7(10)4(5)2-12 |
| InChIKey | JBTPSLFCXVZWLF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,4,6-trichloropyridine-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6-trichloropyridine-3,5-dicarbonitrile?
The IUPAC name of 2,4,6-trichloropyridine-3,5-dicarbonitrile (CID 15206362) is 2,4,6-trichloropyridine-3,5-dicarbonitrile.
What is the SMILES notation for 2,4,6-trichloropyridine-3,5-dicarbonitrile?
The canonical SMILES for 2,4,6-trichloropyridine-3,5-dicarbonitrile is N#Cc1c(Cl)nc(Cl)c(C#N)c1Cl.
What is the InChIKey of 2,4,6-trichloropyridine-3,5-dicarbonitrile?
The InChIKey is JBTPSLFCXVZWLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7Cl3N3/c8-5-3(1-11)6(9)13-7(10)4(5)2-12.
What are the key properties of 2,4,6-trichloropyridine-3,5-dicarbonitrile?
2,4,6-trichloropyridine-3,5-dicarbonitrile has a molecular weight of 232.46 g/mol, XLogP of 2.79, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-trichloropyridine-3,5-dicarbonitrile is sourced from PubChem (CID 15206362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).