C11H4Cl3FN2 — CID 166822994
2,4,6-trichloro-8-fluoro-7-methylquinoline-3-carbonitrile (PubChem CID 166822994) has the molecular formula C11H4Cl3FN2 and a molecular weight of 289.52 g/mol. Its IUPAC name is 2,4,6-trichloro-8-fluoro-7-methylquinoline-3-carbonitrile.
| Compound Name | 2,4,6-trichloro-8-fluoro-7-methylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 166822994 |
| Molecular Formula | C11H4Cl3FN2 |
| Molecular Weight | 289.52 g/mol |
| Exact Mass | 287.94 |
| IUPAC Name | 2,4,6-trichloro-8-fluoro-7-methylquinoline-3-carbonitrile |
| SMILES | Cc1c(Cl)cc2c(Cl)c(C#N)c(Cl)nc2c1F |
| InChI | InChI=1S/C11H4Cl3FN2/c1-4-7(12)2-5-8(13)6(3-16)11(14)17-10(5)9(4)15/h2H,1H3 |
| InChIKey | UOBNAILYGRGBPM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|