C12H6BrCl3FNO2 — CID 155387599
ethyl 7-bromo-2,4,6-trichloro-8-fluoroquinoline-3-carboxylate (PubChem CID 155387599) has the molecular formula C12H6BrCl3FNO2 and a molecular weight of 401.45 g/mol. Its IUPAC name is ethyl 7-bromo-2,4,6-trichloro-8-fluoroquinoline-3-carboxylate.
| Compound Name | ethyl 7-bromo-2,4,6-trichloro-8-fluoroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 155387599 |
| Molecular Formula | C12H6BrCl3FNO2 |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 398.86 |
| IUPAC Name | ethyl 7-bromo-2,4,6-trichloro-8-fluoroquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(Cl)nc2c(F)c(Br)c(Cl)cc2c1Cl |
| InChI | InChI=1S/C12H6BrCl3FNO2/c1-2-20-12(19)6-8(15)4-3-5(14)7(13)9(17)10(4)18-11(6)16/h3H,2H2,1H3 |
| InChIKey | ZHLKBAAHRUHPGH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|