C13H11Cl2NO2 — CID 21050828
ethyl 2,4-dichloro-6-methylquinoline-3-carboxylate (PubChem CID 21050828) has the molecular formula C13H11Cl2NO2 and a molecular weight of 284.14 g/mol. Its IUPAC name is ethyl 2,4-dichloro-6-methylquinoline-3-carboxylate.
| Compound Name | ethyl 2,4-dichloro-6-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 21050828 |
| Molecular Formula | C13H11Cl2NO2 |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | ethyl 2,4-dichloro-6-methylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(Cl)nc2ccc(C)cc2c1Cl |
| InChI | InChI=1S/C13H11Cl2NO2/c1-3-18-13(17)10-11(14)8-6-7(2)4-5-9(8)16-12(10)15/h4-6H,3H2,1-2H3 |
| InChIKey | BSQMPZFIOXDTBX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|