C12H13BrCl3FN2 — CID 156797358
7-bromo-2,4,6-trichloro-8-fluoroquinazoline;ethane (PubChem CID 156797358) has the molecular formula C12H13BrCl3FN2 and a molecular weight of 390.51 g/mol. Its IUPAC name is 7-bromo-2,4,6-trichloro-8-fluoroquinazoline;ethane.
| Compound Name | 7-bromo-2,4,6-trichloro-8-fluoroquinazoline;ethane |
|---|---|
| PubChem CID | 156797358 |
| Molecular Formula | C12H13BrCl3FN2 |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 387.93 |
| IUPAC Name | 7-bromo-2,4,6-trichloro-8-fluoroquinazoline;ethane |
| SMILES | CC.CC.Fc1c(Br)c(Cl)cc2c(Cl)nc(Cl)nc12 |
| InChI | InChI=1S/C8HBrCl3FN2.2C2H6/c9-4-3(10)1-2-6(5(4)13)14-8(12)15-7(2)11;2*1-2/h1H;2*1-2H3 |
| InChIKey | HAWKPBDPZCIYTJ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|