About 2,5-dichloro-4,6-bis(sulfanyl)benzene-1,3-dicarbonitrile
2,5-dichloro-4,6-bis(sulfanyl)benzene-1,3-dicarbonitrile (PubChem CID 100937327) has the molecular formula C8H2Cl2N2S2
and a molecular weight of 261.16 g/mol. Its IUPAC name is 2,5-dichloro-4,6-bis(sulfanyl)benzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 2,5-dichloro-4,6-bis(sulfanyl)benzene-1,3-dicarbonitrile |
| PubChem CID | 100937327 |
| Molecular Formula | C8H2Cl2N2S2 |
| Molecular Weight | 261.16 g/mol |
| Exact Mass | 259.90 |
| IUPAC Name | 2,5-dichloro-4,6-bis(sulfanyl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(S)c(Cl)c(S)c(C#N)c1Cl |
| InChI | InChI=1S/C8H2Cl2N2S2/c9-5-3(1-11)7(13)6(10)8(14)4(5)2-12/h13-14H |
| InChIKey | XVWDIYOGTSEICK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.16 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dichloro-4,6-bis(sulfanyl)benzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichloro-4,6-bis(sulfanyl)benzene-1,3-dicarbonitrile?
The IUPAC name of 2,5-dichloro-4,6-bis(sulfanyl)benzene-1,3-dicarbonitrile (CID 100937327) is 2,5-dichloro-4,6-bis(sulfanyl)benzene-1,3-dicarbonitrile.
What is the SMILES notation for 2,5-dichloro-4,6-bis(sulfanyl)benzene-1,3-dicarbonitrile?
The canonical SMILES for 2,5-dichloro-4,6-bis(sulfanyl)benzene-1,3-dicarbonitrile is N#Cc1c(S)c(Cl)c(S)c(C#N)c1Cl.
What is the InChIKey of 2,5-dichloro-4,6-bis(sulfanyl)benzene-1,3-dicarbonitrile?
The InChIKey is XVWDIYOGTSEICK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2Cl2N2S2/c9-5-3(1-11)7(13)6(10)8(14)4(5)2-12/h13-14H.
What are the key properties of 2,5-dichloro-4,6-bis(sulfanyl)benzene-1,3-dicarbonitrile?
2,5-dichloro-4,6-bis(sulfanyl)benzene-1,3-dicarbonitrile has a molecular weight of 261.16 g/mol, XLogP of 3.31, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-4,6-bis(sulfanyl)benzene-1,3-dicarbonitrile is sourced from PubChem (CID 100937327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).