C8H2Cl2N2S2 — CID 100937327
2,5-dichloro-4,6-bis(sulfanyl)benzene-1,3-dicarbonitrile (PubChem CID 100937327) has the molecular formula C8H2Cl2N2S2 and a molecular weight of 261.16 g/mol. Its IUPAC name is 2,5-dichloro-4,6-bis(sulfanyl)benzene-1,3-dicarbonitrile.
| Compound Name | 2,5-dichloro-4,6-bis(sulfanyl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 100937327 |
| Molecular Formula | C8H2Cl2N2S2 |
| Molecular Weight | 261.16 g/mol |
| Exact Mass | 259.90 |
| IUPAC Name | 2,5-dichloro-4,6-bis(sulfanyl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(S)c(Cl)c(S)c(C#N)c1Cl |
| InChI | InChI=1S/C8H2Cl2N2S2/c9-5-3(1-11)7(13)6(10)8(14)4(5)2-12/h13-14H |
| InChIKey | XVWDIYOGTSEICK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.16 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|