C7HN3OS — CID 139909766
4-sulfanylfuran-2,3,5-tricarbonitrile (PubChem CID 139909766) has the molecular formula C7HN3OS and a molecular weight of 175.17 g/mol. Its IUPAC name is 4-sulfanylfuran-2,3,5-tricarbonitrile.
| Compound Name | 4-sulfanylfuran-2,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 139909766 |
| Molecular Formula | C7HN3OS |
| Molecular Weight | 175.17 g/mol |
| Exact Mass | 174.98 |
| IUPAC Name | 4-sulfanylfuran-2,3,5-tricarbonitrile |
| SMILES | N#Cc1oc(C#N)c(C#N)c1S |
| InChI | InChI=1S/C7HN3OS/c8-1-4-5(2-9)11-6(3-10)7(4)12/h12H |
| InChIKey | CQBSRLRLDUEOPO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.17 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|