C15H9N3O3 — CID 102500191
5-(2,4-dimethoxyphenyl)furan-2,3,4-tricarbonitrile (PubChem CID 102500191) has the molecular formula C15H9N3O3 and a molecular weight of 279.25 g/mol. Its IUPAC name is 5-(2,4-dimethoxyphenyl)furan-2,3,4-tricarbonitrile.
| Compound Name | 5-(2,4-dimethoxyphenyl)furan-2,3,4-tricarbonitrile |
|---|---|
| PubChem CID | 102500191 |
| Molecular Formula | C15H9N3O3 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 5-(2,4-dimethoxyphenyl)furan-2,3,4-tricarbonitrile |
| SMILES | COc1ccc(-c2oc(C#N)c(C#N)c2C#N)c(OC)c1 |
| InChI | InChI=1S/C15H9N3O3/c1-19-9-3-4-10(13(5-9)20-2)15-12(7-17)11(6-16)14(8-18)21-15/h3-5H,1-2H3 |
| InChIKey | DBSCVADZVFMDBU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 102.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |