C42H36O10S4 — CID 101095512
2-[4,6-bis(2,4-dimethoxyphenyl)-[1,3]dithiolo[4,5-c]furan-2-ylidene]-4,6-bis(2,4-dimethoxyphenyl)-[1,3]dithiolo[4,5-c]furan (PubChem CID 101095512) has the molecular formula C42H36O10S4 and a molecular weight of 829.01 g/mol. Its IUPAC name is 2-[4,6-bis(2,4-dimethoxyphenyl)-[1,3]dithiolo[4,5-c]furan-2-ylidene]-4,6-bis(2,4-dimethoxyphenyl)-[1,3]dithiolo[4,5-c]furan.
| Compound Name | 2-[4,6-bis(2,4-dimethoxyphenyl)-[1,3]dithiolo[4,5-c]furan-2-ylidene]-4,6-bis(2,4-dimethoxyphenyl)-[1,3]dithiolo[4,5-c]furan |
|---|---|
| PubChem CID | 101095512 |
| Molecular Formula | C42H36O10S4 |
| Molecular Weight | 829.01 g/mol |
| Exact Mass | 828.12 |
| IUPAC Name | 2-[4,6-bis(2,4-dimethoxyphenyl)-[1,3]dithiolo[4,5-c]furan-2-ylidene]-4,6-bis(2,4-dimethoxyphenyl)-[1,3]dithiolo[4,5-c]furan |
| SMILES | COc1ccc(-c2oc(-c3ccc(OC)cc3OC)c3c2SC(=C2Sc4c(-c5ccc(OC)cc5OC)oc(-c5ccc(OC)cc5OC)c4S2)S3)c(OC)c1 |
| InChI | InChI=1S/C42H36O10S4/c1-43-21-9-13-25(29(17-21)47-5)33-37-38(34(51-33)26-14-10-22(44-2)18-30(26)48-6)54-41(53-37)42-55-39-35(27-15-11-23(45-3)19-31(27)49-7)52-36(40(39)56-42)28-16-12-24(46-4)20-32(28)50-8/h9-20H,1-8H3 |
| InChIKey | UNWFSZAZVDRNHQ-UHFFFAOYSA-N |
| XLogP | 11.83 |
| TPSA | 100.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.01 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |