C15H12FNO2 — CID 172990799
3-(2,4-dimethoxyphenyl)-5-fluorobenzonitrile (PubChem CID 172990799) has the molecular formula C15H12FNO2 and a molecular weight of 257.26 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-5-fluorobenzonitrile.
| Compound Name | 3-(2,4-dimethoxyphenyl)-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 172990799 |
| Molecular Formula | C15H12FNO2 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-5-fluorobenzonitrile |
| SMILES | COc1ccc(-c2cc(F)cc(C#N)c2)c(OC)c1 |
| InChI | InChI=1S/C15H12FNO2/c1-18-13-3-4-14(15(8-13)19-2)11-5-10(9-17)6-12(16)7-11/h3-8H,1-2H3 |
| InChIKey | CWPJVRXPZQZNRY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |