C16H16N4O3 — CID 66920746
N-[4-amino-5-cyano-6-(2,4-dimethoxyphenyl)-2-pyridinyl]acetamide (PubChem CID 66920746) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is N-[4-amino-5-cyano-6-(2,4-dimethoxyphenyl)-2-pyridinyl]acetamide.
| Compound Name | N-[4-amino-5-cyano-6-(2,4-dimethoxyphenyl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 66920746 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-[4-amino-5-cyano-6-(2,4-dimethoxyphenyl)-2-pyridinyl]acetamide |
| SMILES | COc1ccc(-c2nc(NC(C)=O)cc(N)c2C#N)c(OC)c1 |
| InChI | InChI=1S/C16H16N4O3/c1-9(21)19-15-7-13(18)12(8-17)16(20-15)11-5-4-10(22-2)6-14(11)23-3/h4-7H,1-3H3,(H3,18,19,20,21) |
| InChIKey | JKNYFXCZMKMZAL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |