C14H16N2O3 — CID 77093303
2-(2,4-dimethoxyphenyl)-3-methoxypyridin-4-amine (PubChem CID 77093303) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-3-methoxypyridin-4-amine.
| Compound Name | 2-(2,4-dimethoxyphenyl)-3-methoxypyridin-4-amine |
|---|---|
| PubChem CID | 77093303 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-3-methoxypyridin-4-amine |
| SMILES | COc1ccc(-c2nccc(N)c2OC)c(OC)c1 |
| InChI | InChI=1S/C14H16N2O3/c1-17-9-4-5-10(12(8-9)18-2)13-14(19-3)11(15)6-7-16-13/h4-8H,1-3H3,(H2,15,16) |
| InChIKey | NPTZVQVGJVPKPN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |