2-(2,4-dimethoxyphenyl)-4-methylpyridine-3-carboxylic acid

C15H15NO4 — CID 102275828

IUPAC2-(2,4-dimethoxyphenyl)-4-methylpyridine-3-carboxylic acid
SMILESCOc1ccc(-c2nccc(C)c2C(=O)O)c(OC)c1
InChIInChI=1S/C15H15NO4/c1-9-6-7-16-14(13(9)15(17)18)11-5-4-10(19-2)8-12(11)20-3/h4-8H,1-3H3,(H,17,18)
InChIKeyUIVGFMAVJFUCTI-UHFFFAOYSA-N
MW273.29 g/mol
LogP2.77
Rot. Bonds4

About 2-(2,4-dimethoxyphenyl)-4-methylpyridine-3-carboxylic acid

2-(2,4-dimethoxyphenyl)-4-methylpyridine-3-carboxylic acid (PubChem CID 102275828) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-4-methylpyridine-3-carboxylic acid.

Molecular Properties

Compound Name2-(2,4-dimethoxyphenyl)-4-methylpyridine-3-carboxylic acid
PubChem CID102275828
Molecular FormulaC15H15NO4
Molecular Weight273.29 g/mol
Exact Mass273.10
IUPAC Name2-(2,4-dimethoxyphenyl)-4-methylpyridine-3-carboxylic acid
SMILESCOc1ccc(-c2nccc(C)c2C(=O)O)c(OC)c1
InChIInChI=1S/C15H15NO4/c1-9-6-7-16-14(13(9)15(17)18)11-5-4-10(19-2)8-12(11)20-3/h4-8H,1-3H3,(H,17,18)
InChIKeyUIVGFMAVJFUCTI-UHFFFAOYSA-N
XLogP2.77
TPSA68.65 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.29
LogP ≤ 52.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(2,4-dimethoxyphenyl)-4-methylpyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-dimethoxyphenyl)-4-methylpyridine-3-carboxylic acid?
The IUPAC name of 2-(2,4-dimethoxyphenyl)-4-methylpyridine-3-carboxylic acid (CID 102275828) is 2-(2,4-dimethoxyphenyl)-4-methylpyridine-3-carboxylic acid.
What is the SMILES notation for 2-(2,4-dimethoxyphenyl)-4-methylpyridine-3-carboxylic acid?
The canonical SMILES for 2-(2,4-dimethoxyphenyl)-4-methylpyridine-3-carboxylic acid is COc1ccc(-c2nccc(C)c2C(=O)O)c(OC)c1.
What is the InChIKey of 2-(2,4-dimethoxyphenyl)-4-methylpyridine-3-carboxylic acid?
The InChIKey is UIVGFMAVJFUCTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO4/c1-9-6-7-16-14(13(9)15(17)18)11-5-4-10(19-2)8-12(11)20-3/h4-8H,1-3H3,(H,17,18).
What are the key properties of 2-(2,4-dimethoxyphenyl)-4-methylpyridine-3-carboxylic acid?
2-(2,4-dimethoxyphenyl)-4-methylpyridine-3-carboxylic acid has a molecular weight of 273.29 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethoxyphenyl)-4-methylpyridine-3-carboxylic acid is sourced from PubChem (CID 102275828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).