C15H14N4O — CID 122443315
3-(7-methoxyisoquinolin-1-yl)pyridine-2,6-diamine (PubChem CID 122443315) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 3-(7-methoxyisoquinolin-1-yl)pyridine-2,6-diamine.
| Compound Name | 3-(7-methoxyisoquinolin-1-yl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 122443315 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3-(7-methoxyisoquinolin-1-yl)pyridine-2,6-diamine |
| SMILES | COc1ccc2ccnc(-c3ccc(N)nc3N)c2c1 |
| InChI | InChI=1S/C15H14N4O/c1-20-10-3-2-9-6-7-18-14(12(9)8-10)11-4-5-13(16)19-15(11)17/h2-8H,1H3,(H4,16,17,19) |
| InChIKey | FOIUKOASCVFDMY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |