C22H18ClN3O3 — CID 172645812
2-chloro-N-[3-cyano-6-(2,4-dimethoxyphenyl)-4-phenyl-2-pyridinyl]acetamide (PubChem CID 172645812) has the molecular formula C22H18ClN3O3 and a molecular weight of 407.86 g/mol. Its IUPAC name is 2-chloro-N-[3-cyano-6-(2,4-dimethoxyphenyl)-4-phenyl-2-pyridinyl]acetamide.
| Compound Name | 2-chloro-N-[3-cyano-6-(2,4-dimethoxyphenyl)-4-phenyl-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 172645812 |
| Molecular Formula | C22H18ClN3O3 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 2-chloro-N-[3-cyano-6-(2,4-dimethoxyphenyl)-4-phenyl-2-pyridinyl]acetamide |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)c(C#N)c(NC(=O)CCl)n2)c(OC)c1 |
| InChI | InChI=1S/C22H18ClN3O3/c1-28-15-8-9-16(20(10-15)29-2)19-11-17(14-6-4-3-5-7-14)18(13-24)22(25-19)26-21(27)12-23/h3-11H,12H2,1-2H3,(H,25,26,27) |
| InChIKey | RSJHBLDIQOBVOH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|