C31H28N4O5 — CID 173154715
N-[3-cyano-6-[4-methoxy-2-(methoxymethoxy)phenyl]-4-[3-(propanoylamino)phenyl]-2-pyridinyl]benzamide (PubChem CID 173154715) has the molecular formula C31H28N4O5 and a molecular weight of 536.59 g/mol. Its IUPAC name is N-[3-cyano-6-[4-methoxy-2-(methoxymethoxy)phenyl]-4-[3-(propanoylamino)phenyl]-2-pyridinyl]benzamide.
| Compound Name | N-[3-cyano-6-[4-methoxy-2-(methoxymethoxy)phenyl]-4-[3-(propanoylamino)phenyl]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 173154715 |
| Molecular Formula | C31H28N4O5 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | N-[3-cyano-6-[4-methoxy-2-(methoxymethoxy)phenyl]-4-[3-(propanoylamino)phenyl]-2-pyridinyl]benzamide |
| SMILES | CCC(=O)Nc1cccc(-c2cc(-c3ccc(OC)cc3OCOC)nc(NC(=O)c3ccccc3)c2C#N)c1 |
| InChI | InChI=1S/C31H28N4O5/c1-4-29(36)33-22-12-8-11-21(15-22)25-17-27(24-14-13-23(39-3)16-28(24)40-19-38-2)34-30(26(25)18-32)35-31(37)20-9-6-5-7-10-20/h5-17H,4,19H2,1-3H3,(H,33,36)(H,34,35,37) |
| InChIKey | OTGPOQKDKZDJOM-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 122.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|