C25H17ClN4O6 — CID 68956285
N-[6-[4-chloro-2-(methoxymethoxy)phenyl]-3-cyano-4-(3-nitrophenyl)-2-pyridinyl]furan-2-carboxamide (PubChem CID 68956285) has the molecular formula C25H17ClN4O6 and a molecular weight of 504.89 g/mol. Its IUPAC name is N-[6-[4-chloro-2-(methoxymethoxy)phenyl]-3-cyano-4-(3-nitrophenyl)-2-pyridinyl]furan-2-carboxamide.
| Compound Name | N-[6-[4-chloro-2-(methoxymethoxy)phenyl]-3-cyano-4-(3-nitrophenyl)-2-pyridinyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 68956285 |
| Molecular Formula | C25H17ClN4O6 |
| Molecular Weight | 504.89 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | N-[6-[4-chloro-2-(methoxymethoxy)phenyl]-3-cyano-4-(3-nitrophenyl)-2-pyridinyl]furan-2-carboxamide |
| SMILES | COCOc1cc(Cl)ccc1-c1cc(-c2cccc([N+](=O)[O-])c2)c(C#N)c(NC(=O)c2ccco2)n1 |
| InChI | InChI=1S/C25H17ClN4O6/c1-34-14-36-23-11-16(26)7-8-18(23)21-12-19(15-4-2-5-17(10-15)30(32)33)20(13-27)24(28-21)29-25(31)22-6-3-9-35-22/h2-12H,14H2,1H3,(H,28,29,31) |
| InChIKey | PDLNRTWDNCJEOD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 140.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.89 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|