C24H18ClN5O4 — CID 68953110
N-[4-(3-aminophenyl)-6-[4-chloro-2-(methoxymethoxy)phenyl]-3-cyano-2-pyridinyl]-1,2-oxazole-5-carboxamide (PubChem CID 68953110) has the molecular formula C24H18ClN5O4 and a molecular weight of 475.89 g/mol. Its IUPAC name is N-[4-(3-aminophenyl)-6-[4-chloro-2-(methoxymethoxy)phenyl]-3-cyano-2-pyridinyl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[4-(3-aminophenyl)-6-[4-chloro-2-(methoxymethoxy)phenyl]-3-cyano-2-pyridinyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 68953110 |
| Molecular Formula | C24H18ClN5O4 |
| Molecular Weight | 475.89 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | N-[4-(3-aminophenyl)-6-[4-chloro-2-(methoxymethoxy)phenyl]-3-cyano-2-pyridinyl]-1,2-oxazole-5-carboxamide |
| SMILES | COCOc1cc(Cl)ccc1-c1cc(-c2cccc(N)c2)c(C#N)c(NC(=O)c2ccno2)n1 |
| InChI | InChI=1S/C24H18ClN5O4/c1-32-13-33-22-10-15(25)5-6-17(22)20-11-18(14-3-2-4-16(27)9-14)19(12-26)23(29-20)30-24(31)21-7-8-28-34-21/h2-11H,13,27H2,1H3,(H,29,30,31) |
| InChIKey | KTXXLJCOVOGJET-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 136.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.89 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|