C23H21N5O4 — CID 69279537
[3-[2-amino-3-cyano-6-[2-(methoxymethoxy)phenyl]-4-pyridinyl]phenyl]methyliminomethylcarbamic acid (PubChem CID 69279537) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is [3-[2-amino-3-cyano-6-[2-(methoxymethoxy)phenyl]-4-pyridinyl]phenyl]methyliminomethylcarbamic acid.
| Compound Name | [3-[2-amino-3-cyano-6-[2-(methoxymethoxy)phenyl]-4-pyridinyl]phenyl]methyliminomethylcarbamic acid |
|---|---|
| PubChem CID | 69279537 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | [3-[2-amino-3-cyano-6-[2-(methoxymethoxy)phenyl]-4-pyridinyl]phenyl]methyliminomethylcarbamic acid |
| SMILES | COCOc1ccccc1-c1cc(-c2cccc(C/N=C/NC(=O)O)c2)c(C#N)c(N)n1 |
| InChI | InChI=1S/C23H21N5O4/c1-31-14-32-21-8-3-2-7-17(21)20-10-18(19(11-24)22(25)28-20)16-6-4-5-15(9-16)12-26-13-27-23(29)30/h2-10,13H,12,14H2,1H3,(H2,25,28)(H,26,27)(H,29,30) |
| InChIKey | VXJFADWVPRDSHR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 142.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|