C24H24FN5O3 — CID 68957090
N-[3-[2-amino-3-cyano-6-[4-fluoro-2-(methoxymethoxy)phenyl]-4-pyridinyl]phenyl]-2-(dimethylamino)acetamide (PubChem CID 68957090) has the molecular formula C24H24FN5O3 and a molecular weight of 449.49 g/mol. Its IUPAC name is N-[3-[2-amino-3-cyano-6-[4-fluoro-2-(methoxymethoxy)phenyl]-4-pyridinyl]phenyl]-2-(dimethylamino)acetamide.
| Compound Name | N-[3-[2-amino-3-cyano-6-[4-fluoro-2-(methoxymethoxy)phenyl]-4-pyridinyl]phenyl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 68957090 |
| Molecular Formula | C24H24FN5O3 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | N-[3-[2-amino-3-cyano-6-[4-fluoro-2-(methoxymethoxy)phenyl]-4-pyridinyl]phenyl]-2-(dimethylamino)acetamide |
| SMILES | COCOc1cc(F)ccc1-c1cc(-c2cccc(NC(=O)CN(C)C)c2)c(C#N)c(N)n1 |
| InChI | InChI=1S/C24H24FN5O3/c1-30(2)13-23(31)28-17-6-4-5-15(9-17)19-11-21(29-24(27)20(19)12-26)18-8-7-16(25)10-22(18)33-14-32-3/h4-11H,13-14H2,1-3H3,(H2,27,29)(H,28,31) |
| InChIKey | DEFKKXNYOOYGFR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 113.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|