C29H24FN5O6S — CID 69279672
2-[[3-[3-cyano-6-[4-fluoro-2-(methoxymethoxy)phenyl]-2-(thiophene-2-carbonylamino)-4-pyridinyl]benzoyl]amino]ethylcarbamic acid (PubChem CID 69279672) has the molecular formula C29H24FN5O6S and a molecular weight of 589.61 g/mol. Its IUPAC name is 2-[[3-[3-cyano-6-[4-fluoro-2-(methoxymethoxy)phenyl]-2-(thiophene-2-carbonylamino)-4-pyridinyl]benzoyl]amino]ethylcarbamic acid.
| Compound Name | 2-[[3-[3-cyano-6-[4-fluoro-2-(methoxymethoxy)phenyl]-2-(thiophene-2-carbonylamino)-4-pyridinyl]benzoyl]amino]ethylcarbamic acid |
|---|---|
| PubChem CID | 69279672 |
| Molecular Formula | C29H24FN5O6S |
| Molecular Weight | 589.61 g/mol |
| Exact Mass | 589.14 |
| IUPAC Name | 2-[[3-[3-cyano-6-[4-fluoro-2-(methoxymethoxy)phenyl]-2-(thiophene-2-carbonylamino)-4-pyridinyl]benzoyl]amino]ethylcarbamic acid |
| SMILES | COCOc1cc(F)ccc1-c1cc(-c2cccc(C(=O)NCCNC(=O)O)c2)c(C#N)c(NC(=O)c2cccs2)n1 |
| InChI | InChI=1S/C29H24FN5O6S/c1-40-16-41-24-13-19(30)7-8-20(24)23-14-21(22(15-31)26(34-23)35-28(37)25-6-3-11-42-25)17-4-2-5-18(12-17)27(36)32-9-10-33-29(38)39/h2-8,11-14,33H,9-10,16H2,1H3,(H,32,36)(H,38,39)(H,34,35,37) |
| InChIKey | IZOTTZLRSBHJFI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 162.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.61 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|