C28H19ClF3N5O4S — CID 87634202
[2-[4-[3-[[(2S)-2-amino-1-oxopropan-2-yl]amino]phenyl]-5-cyano-6-(thiophene-2-carbonylamino)-2-pyridinyl]-4-chlorophenyl] 2,2,2-trifluoroacetate (PubChem CID 87634202) has the molecular formula C28H19ClF3N5O4S and a molecular weight of 614.01 g/mol. Its IUPAC name is [2-[4-[3-[[(2S)-2-amino-1-oxopropan-2-yl]amino]phenyl]-5-cyano-6-(thiophene-2-carbonylamino)-2-pyridinyl]-4-chlorophenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[4-[3-[[(2S)-2-amino-1-oxopropan-2-yl]amino]phenyl]-5-cyano-6-(thiophene-2-carbonylamino)-2-pyridinyl]-4-chlorophenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87634202 |
| Molecular Formula | C28H19ClF3N5O4S |
| Molecular Weight | 614.01 g/mol |
| Exact Mass | 613.08 |
| IUPAC Name | [2-[4-[3-[[(2S)-2-amino-1-oxopropan-2-yl]amino]phenyl]-5-cyano-6-(thiophene-2-carbonylamino)-2-pyridinyl]-4-chlorophenyl] 2,2,2-trifluoroacetate |
| SMILES | C[C@@](N)(C=O)Nc1cccc(-c2cc(-c3cc(Cl)ccc3OC(=O)C(F)(F)F)nc(NC(=O)c3cccs3)c2C#N)c1 |
| InChI | InChI=1S/C28H19ClF3N5O4S/c1-27(34,14-38)37-17-5-2-4-15(10-17)18-12-21(19-11-16(29)7-8-22(19)41-26(40)28(30,31)32)35-24(20(18)13-33)36-25(39)23-6-3-9-42-23/h2-12,14,37H,34H2,1H3,(H,35,36,39)/t27-/m0/s1 |
| InChIKey | WKYXWSFNNYCWGG-MHZLTWQESA-N |
| XLogP | 6.01 |
| TPSA | 147.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.01 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|