C31H24F3N5O5 — CID 91127227
[2-[4-[3-[[(2S)-2-amino-1-oxopropan-2-yl]amino]phenyl]-6-benzamido-5-cyano-2-pyridinyl]-5-methoxyphenyl] 2,2,2-trifluoroacetate (PubChem CID 91127227) has the molecular formula C31H24F3N5O5 and a molecular weight of 603.56 g/mol. Its IUPAC name is [2-[4-[3-[[(2S)-2-amino-1-oxopropan-2-yl]amino]phenyl]-6-benzamido-5-cyano-2-pyridinyl]-5-methoxyphenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[4-[3-[[(2S)-2-amino-1-oxopropan-2-yl]amino]phenyl]-6-benzamido-5-cyano-2-pyridinyl]-5-methoxyphenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91127227 |
| Molecular Formula | C31H24F3N5O5 |
| Molecular Weight | 603.56 g/mol |
| Exact Mass | 603.17 |
| IUPAC Name | [2-[4-[3-[[(2S)-2-amino-1-oxopropan-2-yl]amino]phenyl]-6-benzamido-5-cyano-2-pyridinyl]-5-methoxyphenyl] 2,2,2-trifluoroacetate |
| SMILES | COc1ccc(-c2cc(-c3cccc(N[C@](C)(N)C=O)c3)c(C#N)c(NC(=O)c3ccccc3)n2)c(OC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C31H24F3N5O5/c1-30(36,17-40)39-20-10-6-9-19(13-20)23-15-25(22-12-11-21(43-2)14-26(22)44-29(42)31(32,33)34)37-27(24(23)16-35)38-28(41)18-7-4-3-5-8-18/h3-15,17,39H,36H2,1-2H3,(H,37,38,41)/t30-/m0/s1 |
| InChIKey | GULFCSCQJUCZPZ-PMERELPUSA-N |
| XLogP | 5.30 |
| TPSA | 156.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|