C25H19N3O — CID 3966942
2-(2-methoxyanilino)-4,6-diphenylpyridine-3-carbonitrile (PubChem CID 3966942) has the molecular formula C25H19N3O and a molecular weight of 377.45 g/mol. Its IUPAC name is 2-(2-methoxyanilino)-4,6-diphenylpyridine-3-carbonitrile.
| Compound Name | 2-(2-methoxyanilino)-4,6-diphenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3966942 |
| Molecular Formula | C25H19N3O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-(2-methoxyanilino)-4,6-diphenylpyridine-3-carbonitrile |
| SMILES | COc1ccccc1Nc1nc(-c2ccccc2)cc(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C25H19N3O/c1-29-24-15-9-8-14-22(24)27-25-21(17-26)20(18-10-4-2-5-11-18)16-23(28-25)19-12-6-3-7-13-19/h2-16H,1H3,(H,27,28) |
| InChIKey | WGZJKVWDQKJKFW-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |