C10H6Cl4N2O — CID 174685103
ethanol;2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile (PubChem CID 174685103) has the molecular formula C10H6Cl4N2O and a molecular weight of 311.98 g/mol. Its IUPAC name is ethanol;2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile.
| Compound Name | ethanol;2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 174685103 |
| Molecular Formula | C10H6Cl4N2O |
| Molecular Weight | 311.98 g/mol |
| Exact Mass | 309.92 |
| IUPAC Name | ethanol;2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile |
| SMILES | CCO.N#Cc1c(Cl)c(Cl)c(Cl)c(C#N)c1Cl |
| InChI | InChI=1S/C8Cl4N2.C2H6O/c9-5-3(1-13)6(10)8(12)7(11)4(5)2-14;1-2-3/h;3H,2H2,1H3 |
| InChIKey | FRCWVMCFBKGWJL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.98 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|