About 4-amino-2,5-dichloro-6-propylsulfanylbenzene-1,3-dicarbonitrile
4-amino-2,5-dichloro-6-propylsulfanylbenzene-1,3-dicarbonitrile (PubChem CID 71580502) has the molecular formula C11H9Cl2N3S
and a molecular weight of 286.19 g/mol. Its IUPAC name is 4-amino-2,5-dichloro-6-propylsulfanylbenzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 4-amino-2,5-dichloro-6-propylsulfanylbenzene-1,3-dicarbonitrile |
| PubChem CID | 71580502 |
| Molecular Formula | C11H9Cl2N3S |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | 4-amino-2,5-dichloro-6-propylsulfanylbenzene-1,3-dicarbonitrile |
| SMILES | CCCSc1c(Cl)c(N)c(C#N)c(Cl)c1C#N |
| InChI | InChI=1S/C11H9Cl2N3S/c1-2-3-17-11-7(5-15)8(12)6(4-14)10(16)9(11)13/h2-3,16H2,1H3 |
| InChIKey | RRZLFIQZMQNEPC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2,5-dichloro-6-propylsulfanylbenzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,5-dichloro-6-propylsulfanylbenzene-1,3-dicarbonitrile?
The IUPAC name of 4-amino-2,5-dichloro-6-propylsulfanylbenzene-1,3-dicarbonitrile (CID 71580502) is 4-amino-2,5-dichloro-6-propylsulfanylbenzene-1,3-dicarbonitrile.
What is the SMILES notation for 4-amino-2,5-dichloro-6-propylsulfanylbenzene-1,3-dicarbonitrile?
The canonical SMILES for 4-amino-2,5-dichloro-6-propylsulfanylbenzene-1,3-dicarbonitrile is CCCSc1c(Cl)c(N)c(C#N)c(Cl)c1C#N.
What is the InChIKey of 4-amino-2,5-dichloro-6-propylsulfanylbenzene-1,3-dicarbonitrile?
The InChIKey is RRZLFIQZMQNEPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl2N3S/c1-2-3-17-11-7(5-15)8(12)6(4-14)10(16)9(11)13/h2-3,16H2,1H3.
What are the key properties of 4-amino-2,5-dichloro-6-propylsulfanylbenzene-1,3-dicarbonitrile?
4-amino-2,5-dichloro-6-propylsulfanylbenzene-1,3-dicarbonitrile has a molecular weight of 286.19 g/mol, XLogP of 3.82, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,5-dichloro-6-propylsulfanylbenzene-1,3-dicarbonitrile is sourced from PubChem (CID 71580502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).