C10H14N4S — CID 100775741
4-amino-6-ethyl-2-propylsulfanylpyrimidine-5-carbonitrile (PubChem CID 100775741) has the molecular formula C10H14N4S and a molecular weight of 222.32 g/mol. Its IUPAC name is 4-amino-6-ethyl-2-propylsulfanylpyrimidine-5-carbonitrile.
| Compound Name | 4-amino-6-ethyl-2-propylsulfanylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 100775741 |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 4-amino-6-ethyl-2-propylsulfanylpyrimidine-5-carbonitrile |
| SMILES | CCCSc1nc(N)c(C#N)c(CC)n1 |
| InChI | InChI=1S/C10H14N4S/c1-3-5-15-10-13-8(4-2)7(6-11)9(12)14-10/h3-5H2,1-2H3,(H2,12,13,14) |
| InChIKey | BAOIIIRUKZFDOP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |