C7H12N6S — CID 144950117
5-diazenyl-2-propylsulfanylpyrimidine-4,6-diamine (PubChem CID 144950117) has the molecular formula C7H12N6S and a molecular weight of 212.28 g/mol. Its IUPAC name is 5-diazenyl-2-propylsulfanylpyrimidine-4,6-diamine.
| Compound Name | 5-diazenyl-2-propylsulfanylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 144950117 |
| Molecular Formula | C7H12N6S |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 5-diazenyl-2-propylsulfanylpyrimidine-4,6-diamine |
| SMILES | [H]/N=N/c1c(N)nc(SCCC)nc1N |
| InChI | InChI=1S/C7H12N6S/c1-2-3-14-7-11-5(8)4(13-10)6(9)12-7/h10H,2-3H2,1H3,(H4,8,9,11,12)/b13-10+ |
| InChIKey | FXVUKXZEQAABNY-JLHYYAGUSA-N |
| XLogP | 1.81 |
| TPSA | 114.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|