C14H25N6PS — CID 138630907
5-[(3-methylcyclopentyl)methyldiazenyl]-4-N-phosphanyl-2-propylsulfanylpyrimidine-4,6-diamine (PubChem CID 138630907) has the molecular formula C14H25N6PS and a molecular weight of 340.44 g/mol. Its IUPAC name is 5-[(3-methylcyclopentyl)methyldiazenyl]-4-N-phosphanyl-2-propylsulfanylpyrimidine-4,6-diamine.
| Compound Name | 5-[(3-methylcyclopentyl)methyldiazenyl]-4-N-phosphanyl-2-propylsulfanylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 138630907 |
| Molecular Formula | C14H25N6PS |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 5-[(3-methylcyclopentyl)methyldiazenyl]-4-N-phosphanyl-2-propylsulfanylpyrimidine-4,6-diamine |
| SMILES | CCCSc1nc(N)c(/N=N/CC2CCC(C)C2)c(NP)n1 |
| InChI | InChI=1S/C14H25N6PS/c1-3-6-22-14-17-12(15)11(13(18-14)20-21)19-16-8-10-5-4-9(2)7-10/h9-10H,3-8,21H2,1-2H3,(H3,15,17,18,20)/b19-16+ |
| InChIKey | FHIVBSDBBWEQDJ-KNTRCKAVSA-N |
| XLogP | 4.28 |
| TPSA | 88.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|