C18H32N6O2S — CID 145150293
6-[amino-[3-[2-(cyclopropylmethoxy)ethoxy]cyclopentyl]amino]-2-propylsulfanylpyrimidine-4,5-diamine (PubChem CID 145150293) has the molecular formula C18H32N6O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is 6-[amino-[3-[2-(cyclopropylmethoxy)ethoxy]cyclopentyl]amino]-2-propylsulfanylpyrimidine-4,5-diamine.
| Compound Name | 6-[amino-[3-[2-(cyclopropylmethoxy)ethoxy]cyclopentyl]amino]-2-propylsulfanylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 145150293 |
| Molecular Formula | C18H32N6O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 6-[amino-[3-[2-(cyclopropylmethoxy)ethoxy]cyclopentyl]amino]-2-propylsulfanylpyrimidine-4,5-diamine |
| SMILES | CCCSc1nc(N)c(N)c(N(N)C2CCC(OCCOCC3CC3)C2)n1 |
| InChI | InChI=1S/C18H32N6O2S/c1-2-9-27-18-22-16(20)15(19)17(23-18)24(21)13-5-6-14(10-13)26-8-7-25-11-12-3-4-12/h12-14H,2-11,19,21H2,1H3,(H2,20,22,23) |
| InChIKey | FBXLXNVIGHRUDL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|