C24H38F2N6O3S — CID 144552802
2-[3-[amino-(5,6-diamino-2-propylsulfanylpyrimidin-4-yl)amino]cyclopentyl]oxyethanol;4-cyclopropyl-1,2-difluorobenzene;methanol (PubChem CID 144552802) has the molecular formula C24H38F2N6O3S and a molecular weight of 528.67 g/mol. Its IUPAC name is 2-[3-[amino-(5,6-diamino-2-propylsulfanylpyrimidin-4-yl)amino]cyclopentyl]oxyethanol;4-cyclopropyl-1,2-difluorobenzene;methanol.
| Compound Name | 2-[3-[amino-(5,6-diamino-2-propylsulfanylpyrimidin-4-yl)amino]cyclopentyl]oxyethanol;4-cyclopropyl-1,2-difluorobenzene;methanol |
|---|---|
| PubChem CID | 144552802 |
| Molecular Formula | C24H38F2N6O3S |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 2-[3-[amino-(5,6-diamino-2-propylsulfanylpyrimidin-4-yl)amino]cyclopentyl]oxyethanol;4-cyclopropyl-1,2-difluorobenzene;methanol |
| SMILES | CCCSc1nc(N)c(N)c(N(N)C2CCC(OCCO)C2)n1.CO.Fc1ccc(C2CC2)cc1F |
| InChI | InChI=1S/C14H26N6O2S.C9H8F2.CH4O/c1-2-7-23-14-18-12(16)11(15)13(19-14)20(17)9-3-4-10(8-9)22-6-5-21;10-8-4-3-7(5-9(8)11)6-1-2-6;1-2/h9-10,21H,2-8,15,17H2,1H3,(H2,16,18,19);3-6H,1-2H2;2H,1H3 |
| InChIKey | HVBFODAEIBKKDP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 156.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|